About copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate
copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate (PubChem CID 139070125) has the molecular formula C32H31BCuN6O2
and a molecular weight of 606.00 g/mol. Its IUPAC name is copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate.
Molecular Properties
| Compound Name | copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate |
| PubChem CID | 139070125 |
| Molecular Formula | C32H31BCuN6O2 |
| Molecular Weight | 606.00 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate |
| SMILES | CC(=O)[O-].Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.[Cu+2] |
| InChI | InChI=1S/C30H28BN6.C2H4O2.Cu/c1-22-19-28(25-13-7-4-8-14-25)32-35(22)31(36-23(2)20-29(33-36)26-15-9-5-10-16-26)37-24(3)21-30(34-37)27-17-11-6-12-18-27;1-2(3)4;/h4-21,31H,1-3H3;1H3,(H,3,4);/q-1;;+2/p-1 |
| InChIKey | MPSNRJZQSNAJNE-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 606.00 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate?
The IUPAC name of copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate (CID 139070125) is copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate.
What is the SMILES notation for copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate?
The canonical SMILES for copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate is CC(=O)[O-].Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.[Cu+2].
What is the InChIKey of copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate?
The InChIKey is MPSNRJZQSNAJNE-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H28BN6.C2H4O2.Cu/c1-22-19-28(25-13-7-4-8-14-25)32-35(22)31(36-23(2)20-29(33-36)26-15-9-5-10-16-26)37-24(3)21-30(34-37)27-17-11-6-12-18-27;1-2(3)4;/h4-21,31H,1-3H3;1H3,(H,3,4);/q-1;;+2/p-1.
What are the key properties of copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate?
copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate has a molecular weight of 606.00 g/mol, XLogP of 4.62, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;acetate is sourced from PubChem (CID 139070125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).