About palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate)
palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) (PubChem CID 139136788) has the molecular formula C16H16N2O2Pd
and a molecular weight of 374.74 g/mol. Its IUPAC name is palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate).
Molecular Properties
| Compound Name | palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) |
| PubChem CID | 139136788 |
| Molecular Formula | C16H16N2O2Pd |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) |
| SMILES | C/C([O-])=C/c1ccccn1.C/C([O-])=C/c1ccccn1.[Pd+2] |
| InChI | InChI=1S/2C8H9NO.Pd/c2*1-7(10)6-8-4-2-3-5-9-8;/h2*2-6,10H,1H3;/q;;+2/p-2/b2*7-6-; |
| InChIKey | OOLVNLCZUJINOB-SVDRMMRJSA-L |
| XLogP | 1.60 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate)?
The IUPAC name of palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) (CID 139136788) is palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate).
What is the SMILES notation for palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate)?
The canonical SMILES for palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) is C/C([O-])=C/c1ccccn1.C/C([O-])=C/c1ccccn1.[Pd+2].
What is the InChIKey of palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate)?
The InChIKey is OOLVNLCZUJINOB-SVDRMMRJSA-L. The full InChI is InChI=1S/2C8H9NO.Pd/c2*1-7(10)6-8-4-2-3-5-9-8;/h2*2-6,10H,1H3;/q;;+2/p-2/b2*7-6-;.
What are the key properties of palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate)?
palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) has a molecular weight of 374.74 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);bis((Z)-1-pyridin-2-ylprop-1-en-2-olate) is sourced from PubChem (CID 139136788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).