C62H82N4NiO6 — CID 139136991
bis(2,4-ditert-butyl-6-[[2-(5,7-ditert-butyl-1,3-benzoxazol-2-yl)-2-oxoethylidene]amino]phenolate);nickel(2+) (PubChem CID 139136991) has the molecular formula C62H82N4NiO6 and a molecular weight of 1038.05 g/mol. Its IUPAC name is bis(2,4-ditert-butyl-6-[[2-(5,7-ditert-butyl-1,3-benzoxazol-2-yl)-2-oxoethylidene]amino]phenolate);nickel(2+).
| Compound Name | bis(2,4-ditert-butyl-6-[[2-(5,7-ditert-butyl-1,3-benzoxazol-2-yl)-2-oxoethylidene]amino]phenolate);nickel(2+) |
|---|---|
| PubChem CID | 139136991 |
| Molecular Formula | C62H82N4NiO6 |
| Molecular Weight | 1038.05 g/mol |
| Exact Mass | 1036.56 |
| IUPAC Name | bis(2,4-ditert-butyl-6-[[2-(5,7-ditert-butyl-1,3-benzoxazol-2-yl)-2-oxoethylidene]amino]phenolate);nickel(2+) |
| SMILES | CC(C)(C)c1cc(/N=C/C(=O)c2nc3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)c([O-])c(C(C)(C)C)c1.CC(C)(C)c1cc(N=CC(=O)c2nc3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)c([O-])c(C(C)(C)C)c1.[Ni+2] |
| InChI | InChI=1S/2C31H42N2O3.Ni/c2*1-28(2,3)18-13-20(30(7,8)9)25(35)22(15-18)32-17-24(34)27-33-23-16-19(29(4,5)6)14-21(26(23)36-27)31(10,11)12;/h2*13-17,35H,1-12H3;/q;;+2/p-2/b32-17+;; |
| InChIKey | CVDUDCQKYXEEHY-YZHVHOQKSA-L |
| XLogP | 15.35 |
| TPSA | 157.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.05 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|