C60H56B2N12Ni — CID 139137458
nickel(2+);bis(tris(5-methyl-3-phenylpyrazol-1-yl)boranuide) (PubChem CID 139137458) has the molecular formula C60H56B2N12Ni and a molecular weight of 1025.51 g/mol. Its IUPAC name is nickel(2+);bis(tris(5-methyl-3-phenylpyrazol-1-yl)boranuide).
| Compound Name | nickel(2+);bis(tris(5-methyl-3-phenylpyrazol-1-yl)boranuide) |
|---|---|
| PubChem CID | 139137458 |
| Molecular Formula | C60H56B2N12Ni |
| Molecular Weight | 1025.51 g/mol |
| Exact Mass | 1024.43 |
| IUPAC Name | nickel(2+);bis(tris(5-methyl-3-phenylpyrazol-1-yl)boranuide) |
| SMILES | Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.[Ni+2] |
| InChI | InChI=1S/2C30H28BN6.Ni/c2*1-22-19-28(25-13-7-4-8-14-25)32-35(22)31(36-23(2)20-29(33-36)26-15-9-5-10-16-26)37-24(3)21-30(34-37)27-17-11-6-12-18-27;/h2*4-21,31H,1-3H3;/q2*-1;+2 |
| InChIKey | XKNFGAMWTIDNFV-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.51 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|