C30H18N8O6S2 — CID 139140035
benzene-1,4-diol;bis([1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline 2,2-dioxide) (PubChem CID 139140035) has the molecular formula C30H18N8O6S2 and a molecular weight of 650.66 g/mol. Its IUPAC name is benzene-1,4-diol;bis([1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline 2,2-dioxide).
| Compound Name | benzene-1,4-diol;bis([1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline 2,2-dioxide) |
|---|---|
| PubChem CID | 139140035 |
| Molecular Formula | C30H18N8O6S2 |
| Molecular Weight | 650.66 g/mol |
| Exact Mass | 650.08 |
| IUPAC Name | benzene-1,4-diol;bis([1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline 2,2-dioxide) |
| SMILES | O=S1(=O)N=c2c(c3cccnc3c3ncccc23)=N1.O=S1(=O)N=c2c(c3cccnc3c3ncccc23)=N1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/2C12H6N4O2S.C6H6O2/c2*17-19(18)15-11-7-3-1-5-13-9(7)10-8(12(11)16-19)4-2-6-14-10;7-5-1-2-6(8)4-3-5/h2*1-6H;1-4,7-8H |
| InChIKey | OJQOBJBYQVBUJR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 209.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.66 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|