About phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine
phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine (PubChem CID 158719979) has the molecular formula C30H26N4O4S
and a molecular weight of 538.63 g/mol. Its IUPAC name is phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine.
Molecular Properties
| Compound Name | phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine |
| PubChem CID | 158719979 |
| Molecular Formula | C30H26N4O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine |
| SMILES | Nc1cccc2cccnc12.O=S(=O)(Nc1cccc2cccnc12)Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C15H12N2O3S.C9H8N2.C6H6O/c18-21(19,20-13-8-2-1-3-9-13)17-14-10-4-6-12-7-5-11-16-15(12)14;10-8-5-1-3-7-4-2-6-11-9(7)8;7-6-4-2-1-3-5-6/h1-11,17H;1-6H,10H2;1-5,7H |
| InChIKey | IJUGSSIZIVDAMQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine?
The IUPAC name of phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine (CID 158719979) is phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine.
What is the SMILES notation for phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine?
The canonical SMILES for phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine is Nc1cccc2cccnc12.O=S(=O)(Nc1cccc2cccnc12)Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine?
The InChIKey is IJUGSSIZIVDAMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3S.C9H8N2.C6H6O/c18-21(19,20-13-8-2-1-3-9-13)17-14-10-4-6-12-7-5-11-16-15(12)14;10-8-5-1-3-7-4-2-6-11-9(7)8;7-6-4-2-1-3-5-6/h1-11,17H;1-6H,10H2;1-5,7H.
What are the key properties of phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine?
phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine has a molecular weight of 538.63 g/mol, XLogP of 6.18, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;phenyl N-quinolin-8-ylsulfamate;quinolin-8-amine is sourced from PubChem (CID 158719979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).