About manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate)
manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) (PubChem CID 139140410) has the molecular formula C38H24MnN6O2
and a molecular weight of 651.59 g/mol. Its IUPAC name is manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate).
Molecular Properties
| Compound Name | manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) |
| PubChem CID | 139140410 |
| Molecular Formula | C38H24MnN6O2 |
| Molecular Weight | 651.59 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) |
| SMILES | [Mn+2].[O-]c1c(/N=N/c2ccccn2)c2ccccc2c2ccccc12.[O-]c1c(/N=N/c2ccccn2)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/2C19H13N3O.Mn/c2*23-19-16-10-4-2-8-14(16)13-7-1-3-9-15(13)18(19)22-21-17-11-5-6-12-20-17;/h2*1-12,23H;/q;;+2/p-2/b2*22-21+; |
| InChIKey | IHMUMGVXTHJVAL-JTVZJQPRSA-L |
| XLogP | 9.75 |
| TPSA | 121.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.59 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate)?
The IUPAC name of manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) (CID 139140410) is manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate).
What is the SMILES notation for manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate)?
The canonical SMILES for manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) is [Mn+2].[O-]c1c(/N=N/c2ccccn2)c2ccccc2c2ccccc12.[O-]c1c(/N=N/c2ccccn2)c2ccccc2c2ccccc12.
What is the InChIKey of manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate)?
The InChIKey is IHMUMGVXTHJVAL-JTVZJQPRSA-L. The full InChI is InChI=1S/2C19H13N3O.Mn/c2*23-19-16-10-4-2-8-14(16)13-7-1-3-9-15(13)18(19)22-21-17-11-5-6-12-20-17;/h2*1-12,23H;/q;;+2/p-2/b2*22-21+;.
What are the key properties of manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate)?
manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) has a molecular weight of 651.59 g/mol, XLogP of 9.75, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(10-(pyridin-2-yldiazenyl)phenanthren-9-olate) is sourced from PubChem (CID 139140410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).