C38H48CrN6O2 — CID 139142975
chromium(2+);bis(2,4-ditert-butyl-6-(pyridin-2-yldiazenyl)phenolate) (PubChem CID 139142975) has the molecular formula C38H48CrN6O2 and a molecular weight of 672.84 g/mol. Its IUPAC name is chromium(2+);bis(2,4-ditert-butyl-6-(pyridin-2-yldiazenyl)phenolate).
| Compound Name | chromium(2+);bis(2,4-ditert-butyl-6-(pyridin-2-yldiazenyl)phenolate) |
|---|---|
| PubChem CID | 139142975 |
| Molecular Formula | C38H48CrN6O2 |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | chromium(2+);bis(2,4-ditert-butyl-6-(pyridin-2-yldiazenyl)phenolate) |
| SMILES | CC(C)(C)c1cc(/N=N/c2ccccn2)c([O-])c(C(C)(C)C)c1.CC(C)(C)c1cc(/N=N\c2ccccn2)c([O-])c(C(C)(C)C)c1.[Cr+2] |
| InChI | InChI=1S/2C19H25N3O.Cr/c2*1-18(2,3)13-11-14(19(4,5)6)17(23)15(12-13)21-22-16-9-7-8-10-20-16;/h2*7-12,23H,1-6H3;/q;;+2/p-2/b22-21+;22-21-; |
| InChIKey | NRUPEXWKZKHENG-BYGJQZHASA-L |
| XLogP | 10.33 |
| TPSA | 121.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|