C33H34N4O3 — CID 139140719
2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide;methanol (PubChem CID 139140719) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide;methanol.
| Compound Name | 2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide;methanol |
|---|---|
| PubChem CID | 139140719 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide;methanol |
| SMILES | CCN(C(=O)c1ccc2ccc3ccc(C(=O)N(CC)c4ccc(C)cc4)nc3c2n1)c1ccc(C)cc1.CO |
| InChI | InChI=1S/C32H30N4O2.CH4O/c1-5-35(25-15-7-21(3)8-16-25)31(37)27-19-13-23-11-12-24-14-20-28(34-30(24)29(23)33-27)32(38)36(6-2)26-17-9-22(4)10-18-26;1-2/h7-20H,5-6H2,1-4H3;2H,1H3 |
| InChIKey | KUDJNLORDVZLDO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|