About 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+)
2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) (PubChem CID 139141168) has the molecular formula C34H26N6O2Ru
and a molecular weight of 651.69 g/mol. Its IUPAC name is 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+).
Molecular Properties
| Compound Name | 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) |
| PubChem CID | 139141168 |
| Molecular Formula | C34H26N6O2Ru |
| Molecular Weight | 651.69 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) |
| SMILES | [O-]c1ccccc1-c1ccccc1[O-].[Ru+2].c1ccc(/N=N/c2ccccn2)cc1.c1ccc(/N=N/c2ccccn2)cc1 |
| InChI | InChI=1S/C12H10O2.2C11H9N3.Ru/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14;2*1-2-6-10(7-3-1)13-14-11-8-4-5-9-12-11;/h1-8,13-14H;2*1-9H;/q;;;+2/p-2/b;2*14-13+; |
| InChIKey | IUMVSHOURHPRGR-XVMIXBNESA-L |
| XLogP | 8.49 |
| TPSA | 121.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.69 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+)?
The IUPAC name of 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) (CID 139141168) is 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+).
What is the SMILES notation for 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+)?
The canonical SMILES for 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) is [O-]c1ccccc1-c1ccccc1[O-].[Ru+2].c1ccc(/N=N/c2ccccn2)cc1.c1ccc(/N=N/c2ccccn2)cc1.
What is the InChIKey of 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+)?
The InChIKey is IUMVSHOURHPRGR-XVMIXBNESA-L. The full InChI is InChI=1S/C12H10O2.2C11H9N3.Ru/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14;2*1-2-6-10(7-3-1)13-14-11-8-4-5-9-12-11;/h1-8,13-14H;2*1-9H;/q;;;+2/p-2/b;2*14-13+;.
What are the key properties of 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+)?
2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) has a molecular weight of 651.69 g/mol, XLogP of 8.49, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxidophenyl)phenolate;bis(phenyl(pyridin-2-yl)diazene);ruthenium(2+) is sourced from PubChem (CID 139141168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).