About iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate)
iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) (PubChem CID 139142660) has the molecular formula C32H20FeN6O6
and a molecular weight of 640.39 g/mol. Its IUPAC name is iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate).
Molecular Properties
| Compound Name | iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) |
| PubChem CID | 139142660 |
| Molecular Formula | C32H20FeN6O6 |
| Molecular Weight | 640.39 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) |
| SMILES | O=[N+]([O-])c1ccc([O-])c(/C=N/c2cccc3cccnc23)c1.O=[N+]([O-])c1ccc([O-])c(C=Nc2cccc3cccnc23)c1.[Fe+2] |
| InChI | InChI=1S/2C16H11N3O3.Fe/c2*20-15-7-6-13(19(21)22)9-12(15)10-18-14-5-1-3-11-4-2-8-17-16(11)14;/h2*1-10,20H;/q;;+2/p-2/b18-10+;; |
| InChIKey | SCKPIZMGHTVYSX-LCCCTGDHSA-L |
| XLogP | 5.93 |
| TPSA | 182.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate)?
The IUPAC name of iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) (CID 139142660) is iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate).
What is the SMILES notation for iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate)?
The canonical SMILES for iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) is O=[N+]([O-])c1ccc([O-])c(/C=N/c2cccc3cccnc23)c1.O=[N+]([O-])c1ccc([O-])c(C=Nc2cccc3cccnc23)c1.[Fe+2].
What is the InChIKey of iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate)?
The InChIKey is SCKPIZMGHTVYSX-LCCCTGDHSA-L. The full InChI is InChI=1S/2C16H11N3O3.Fe/c2*20-15-7-6-13(19(21)22)9-12(15)10-18-14-5-1-3-11-4-2-8-17-16(11)14;/h2*1-10,20H;/q;;+2/p-2/b18-10+;;.
What are the key properties of iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate)?
iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) has a molecular weight of 640.39 g/mol, XLogP of 5.93, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(4-nitro-2-(quinolin-8-yliminomethyl)phenolate) is sourced from PubChem (CID 139142660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).