C31H23BN2O — CID 139142837
9,9,17-triphenyl-8-oxa-17-aza-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene (PubChem CID 139142837) has the molecular formula C31H23BN2O and a molecular weight of 450.35 g/mol. Its IUPAC name is 9,9,17-triphenyl-8-oxa-17-aza-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene.
| Compound Name | 9,9,17-triphenyl-8-oxa-17-aza-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene |
|---|---|
| PubChem CID | 139142837 |
| Molecular Formula | C31H23BN2O |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 9,9,17-triphenyl-8-oxa-17-aza-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene |
| SMILES | c1ccc(-n2c3[n+](c4ccccc42)[B-](c2ccccc2)(c2ccccc2)Oc2ccccc2-3)cc1 |
| InChI | InChI=1S/C31H23BN2O/c1-4-14-24(15-5-1)32(25-16-6-2-7-17-25)34-29-22-12-11-21-28(29)33(26-18-8-3-9-19-26)31(34)27-20-10-13-23-30(27)35-32/h1-23H |
| InChIKey | AZZGEXFDUZNEBI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|