C27H19BF2N2O — CID 139166250
7,7-difluoro-3,4,5-triphenyl-8-oxa-3-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaene (PubChem CID 139166250) has the molecular formula C27H19BF2N2O and a molecular weight of 436.27 g/mol. Its IUPAC name is 7,7-difluoro-3,4,5-triphenyl-8-oxa-3-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaene.
| Compound Name | 7,7-difluoro-3,4,5-triphenyl-8-oxa-3-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaene |
|---|---|
| PubChem CID | 139166250 |
| Molecular Formula | C27H19BF2N2O |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 7,7-difluoro-3,4,5-triphenyl-8-oxa-3-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaene |
| SMILES | F[B-]1(F)Oc2ccccc2-c2n(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)[n+]21 |
| InChI | InChI=1S/C27H19BF2N2O/c29-28(30)32-26(21-14-6-2-7-15-21)25(20-12-4-1-5-13-20)31(22-16-8-3-9-17-22)27(32)23-18-10-11-19-24(23)33-28/h1-19H |
| InChIKey | YRSOGHKTFWDQPG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|