C13H11N3O5 — CID 139144662
2-carboxypyridine-3-carboxylate;pyridin-1-ium-4-carboxamide (PubChem CID 139144662) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-carboxypyridine-3-carboxylate;pyridin-1-ium-4-carboxamide.
| Compound Name | 2-carboxypyridine-3-carboxylate;pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 139144662 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-carboxypyridine-3-carboxylate;pyridin-1-ium-4-carboxamide |
| SMILES | NC(=O)c1cc[nH+]cc1.O=C([O-])c1cccnc1C(=O)O |
| InChI | InChI=1S/C7H5NO4.C6H6N2O/c9-6(10)4-2-1-3-8-5(4)7(11)12;7-6(9)5-1-3-8-4-2-5/h1-3H,(H,9,10)(H,11,12);1-4H,(H2,7,9) |
| InChIKey | MQKOZECYEJLCJT-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |