C48H66N2O4 — CID 139145741
4-[2-(1-adamantyl)acetyl]-N-[(2R)-3-methylbutan-2-yl]benzamide (PubChem CID 139145741) has the molecular formula C48H66N2O4 and a molecular weight of 735.07 g/mol. Its IUPAC name is 4-[2-(1-adamantyl)acetyl]-N-[(2R)-3-methylbutan-2-yl]benzamide.
| Compound Name | 4-[2-(1-adamantyl)acetyl]-N-[(2R)-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 139145741 |
| Molecular Formula | C48H66N2O4 |
| Molecular Weight | 735.07 g/mol |
| Exact Mass | 734.50 |
| IUPAC Name | 4-[2-(1-adamantyl)acetyl]-N-[(2R)-3-methylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@@H](C)NC(=O)c1ccc(C(=O)CC23CC4CC(CC(C4)C2)C3)cc1.CC(C)[C@@H](C)NC(=O)c1ccc(C(=O)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/2C24H33NO2/c2*1-15(2)16(3)25-23(27)21-6-4-20(5-7-21)22(26)14-24-11-17-8-18(12-24)10-19(9-17)13-24/h2*4-7,15-19H,8-14H2,1-3H3,(H,25,27)/t2*16-,17?,18?,19?,24?/m11/s1 |
| InChIKey | HQODBPKFIPBLTG-SAOLALDJSA-N |
| XLogP | 10.50 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.07 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |