C26H28N4O6 — CID 139145761
5-[[2-(4-carboxybutylamino)-2-oxoacetyl]amino]pentanoic acid;3-(4-pyridin-3-ylbuta-1,3-diynyl)pyridine (PubChem CID 139145761) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is 5-[[2-(4-carboxybutylamino)-2-oxoacetyl]amino]pentanoic acid;3-(4-pyridin-3-ylbuta-1,3-diynyl)pyridine.
| Compound Name | 5-[[2-(4-carboxybutylamino)-2-oxoacetyl]amino]pentanoic acid;3-(4-pyridin-3-ylbuta-1,3-diynyl)pyridine |
|---|---|
| PubChem CID | 139145761 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 5-[[2-(4-carboxybutylamino)-2-oxoacetyl]amino]pentanoic acid;3-(4-pyridin-3-ylbuta-1,3-diynyl)pyridine |
| SMILES | C(C#Cc1cccnc1)#Cc1cccnc1.O=C(O)CCCCNC(=O)C(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C14H8N2.C12H20N2O6/c1(5-13-7-3-9-15-11-13)2-6-14-8-4-10-16-12-14;15-9(16)5-1-3-7-13-11(19)12(20)14-8-4-2-6-10(17)18/h3-4,7-12H;1-8H2,(H,13,19)(H,14,20)(H,15,16)(H,17,18) |
| InChIKey | ICLSGMABKMJBQK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|