C35H44N2O3 — CID 139146258
tert-butylazanium;(2S)-3-phenyl-2-(tritylamino)propanoate;propan-2-ol (PubChem CID 139146258) has the molecular formula C35H44N2O3 and a molecular weight of 540.75 g/mol. Its IUPAC name is tert-butylazanium;(2S)-3-phenyl-2-(tritylamino)propanoate;propan-2-ol.
| Compound Name | tert-butylazanium;(2S)-3-phenyl-2-(tritylamino)propanoate;propan-2-ol |
|---|---|
| PubChem CID | 139146258 |
| Molecular Formula | C35H44N2O3 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.34 |
| IUPAC Name | tert-butylazanium;(2S)-3-phenyl-2-(tritylamino)propanoate;propan-2-ol |
| SMILES | CC(C)(C)[NH3+].CC(C)O.O=C([O-])[C@H](Cc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25NO2.C4H11N.C3H8O/c30-27(31)26(21-22-13-5-1-6-14-22)29-28(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-4(2,3)5;1-3(2)4/h1-20,26,29H,21H2,(H,30,31);5H2,1-3H3;3-4H,1-2H3/t26-;;/m0../s1 |
| InChIKey | KWRIFCHGUAKVDP-ROPHLPQBSA-N |
| XLogP | 4.34 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|