About butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate)
butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) (PubChem CID 139147141) has the molecular formula C28H24N6O14S2
and a molecular weight of 732.66 g/mol. Its IUPAC name is butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate).
Molecular Properties
| Compound Name | butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) |
| PubChem CID | 139147141 |
| Molecular Formula | C28H24N6O14S2 |
| Molecular Weight | 732.66 g/mol |
| Exact Mass | 732.08 |
| IUPAC Name | butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C12H9N3O5S.C4H6O4/c2*1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19;5-3(6)1-2-4(7)8/h2*2-6H,1H3,(H,13,14,17);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PUSLHUIOUGVJKD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 297.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 732.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate)?
The IUPAC name of butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) (CID 139147141) is butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate).
What is the SMILES notation for butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate)?
The canonical SMILES for butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) is CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate)?
The InChIKey is PUSLHUIOUGVJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H9N3O5S.C4H6O4/c2*1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19;5-3(6)1-2-4(7)8/h2*2-6H,1H3,(H,13,14,17);1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate)?
butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) has a molecular weight of 732.66 g/mol, XLogP of 4.39, 11 rotatable bonds, 4 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;bis([2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate) is sourced from PubChem (CID 139147141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).