About (4-bromophenyl)boronic acid;4,7-phenanthroline
(4-bromophenyl)boronic acid;4,7-phenanthroline (PubChem CID 139147530) has the molecular formula C18H14BBrN2O2
and a molecular weight of 381.04 g/mol. Its IUPAC name is (4-bromophenyl)boronic acid;4,7-phenanthroline.
Molecular Properties
| Compound Name | (4-bromophenyl)boronic acid;4,7-phenanthroline |
| PubChem CID | 139147530 |
| Molecular Formula | C18H14BBrN2O2 |
| Molecular Weight | 381.04 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | (4-bromophenyl)boronic acid;4,7-phenanthroline |
| SMILES | OB(O)c1ccc(Br)cc1.c1cnc2ccc3ncccc3c2c1 |
| InChI | InChI=1S/C12H8N2.C6H6BBrO2/c1-3-9-10-4-2-8-14-12(10)6-5-11(9)13-7-1;8-6-3-1-5(2-4-6)7(9)10/h1-8H;1-4,9-10H |
| InChIKey | BLLYPLZLINPNDN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.04 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)boronic acid;4,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)boronic acid;4,7-phenanthroline?
The IUPAC name of (4-bromophenyl)boronic acid;4,7-phenanthroline (CID 139147530) is (4-bromophenyl)boronic acid;4,7-phenanthroline.
What is the SMILES notation for (4-bromophenyl)boronic acid;4,7-phenanthroline?
The canonical SMILES for (4-bromophenyl)boronic acid;4,7-phenanthroline is OB(O)c1ccc(Br)cc1.c1cnc2ccc3ncccc3c2c1.
What is the InChIKey of (4-bromophenyl)boronic acid;4,7-phenanthroline?
The InChIKey is BLLYPLZLINPNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C6H6BBrO2/c1-3-9-10-4-2-8-14-12(10)6-5-11(9)13-7-1;8-6-3-1-5(2-4-6)7(9)10/h1-8H;1-4,9-10H.
What are the key properties of (4-bromophenyl)boronic acid;4,7-phenanthroline?
(4-bromophenyl)boronic acid;4,7-phenanthroline has a molecular weight of 381.04 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)boronic acid;4,7-phenanthroline is sourced from PubChem (CID 139147530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).