About (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate
(4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate (PubChem CID 139147533) has the molecular formula C16H16BBrN2O3
and a molecular weight of 375.03 g/mol. Its IUPAC name is (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate.
Molecular Properties
| Compound Name | (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate |
| PubChem CID | 139147533 |
| Molecular Formula | C16H16BBrN2O3 |
| Molecular Weight | 375.03 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate |
| SMILES | O.OB(O)c1ccc(Br)cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C6H6BBrO2.H2O/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;8-6-3-1-5(2-4-6)7(9)10;/h1-8H;1-4,9-10H;1H2 |
| InChIKey | SLKGZMYWROBSBU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.03 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate?
The IUPAC name of (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate (CID 139147533) is (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate.
What is the SMILES notation for (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate?
The canonical SMILES for (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate is O.OB(O)c1ccc(Br)cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate?
The InChIKey is SLKGZMYWROBSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C6H6BBrO2.H2O/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;8-6-3-1-5(2-4-6)7(9)10;/h1-8H;1-4,9-10H;1H2.
What are the key properties of (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate?
(4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate has a molecular weight of 375.03 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)boronic acid;4-pyridin-4-ylpyridine;hydrate is sourced from PubChem (CID 139147533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).