C19H20O4S — CID 139148215
3-[(R)-benzylsulfonyl(phenyl)methyl]pentane-2,4-dione (PubChem CID 139148215) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is 3-[(R)-benzylsulfonyl(phenyl)methyl]pentane-2,4-dione.
| Compound Name | 3-[(R)-benzylsulfonyl(phenyl)methyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 139148215 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-[(R)-benzylsulfonyl(phenyl)methyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@H](c1ccccc1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H20O4S/c1-14(20)18(15(2)21)19(17-11-7-4-8-12-17)24(22,23)13-16-9-5-3-6-10-16/h3-12,18-19H,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | WVPVTQSOXGSQRT-IBGZPJMESA-N |
| XLogP | 3.14 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|