C17H21NO3S — CID 139148474
1-[(3S)-3-[(E)-but-2-enyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrol-4-yl]ethanone (PubChem CID 139148474) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[(3S)-3-[(E)-but-2-enyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrol-4-yl]ethanone.
| Compound Name | 1-[(3S)-3-[(E)-but-2-enyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrol-4-yl]ethanone |
|---|---|
| PubChem CID | 139148474 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[(3S)-3-[(E)-but-2-enyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrol-4-yl]ethanone |
| SMILES | C/C=C/C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)C=C1C(C)=O |
| InChI | InChI=1S/C17H21NO3S/c1-4-5-6-15-11-18(12-17(15)14(3)19)22(20,21)16-9-7-13(2)8-10-16/h4-5,7-10,12,15H,6,11H2,1-3H3/b5-4+/t15-/m1/s1 |
| InChIKey | TVGQLDNVNBYJPP-MBVDDHJVSA-N |
| XLogP | 3.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|