C22H12F12NOP — CID 139149957
2-[bis[3,5-bis(trifluoromethyl)phenyl]phosphorylmethyl]pyridine (PubChem CID 139149957) has the molecular formula C22H12F12NOP and a molecular weight of 565.29 g/mol. Its IUPAC name is 2-[bis[3,5-bis(trifluoromethyl)phenyl]phosphorylmethyl]pyridine.
| Compound Name | 2-[bis[3,5-bis(trifluoromethyl)phenyl]phosphorylmethyl]pyridine |
|---|---|
| PubChem CID | 139149957 |
| Molecular Formula | C22H12F12NOP |
| Molecular Weight | 565.29 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | 2-[bis[3,5-bis(trifluoromethyl)phenyl]phosphorylmethyl]pyridine |
| SMILES | O=P(Cc1ccccn1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H12F12NOP/c23-19(24,25)12-5-13(20(26,27)28)8-17(7-12)37(36,11-16-3-1-2-4-35-16)18-9-14(21(29,30)31)6-15(10-18)22(32,33)34/h1-10H,11H2 |
| InChIKey | FBZRHCRRRSWNNW-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.29 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|