C34H36F12N2O2Zn — CID 139150187
zinc bis(4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-olate) (PubChem CID 139150187) has the molecular formula C34H36F12N2O2Zn and a molecular weight of 798.04 g/mol. Its IUPAC name is zinc bis(4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-olate).
| Compound Name | zinc bis(4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-olate) |
|---|---|
| PubChem CID | 139150187 |
| Molecular Formula | C34H36F12N2O2Zn |
| Molecular Weight | 798.04 g/mol |
| Exact Mass | 796.19 |
| IUPAC Name | zinc bis(4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-olate) |
| SMILES | [O-]C(C/C(=N/C1CCCCC1)c1ccccc1)(C(F)(F)F)C(F)(F)F.[O-]C(C/C(=N/C1CCCCC1)c1ccccc1)(C(F)(F)F)C(F)(F)F.[Zn+2] |
| InChI | InChI=1S/2C17H18F6NO.Zn/c2*18-16(19,20)15(25,17(21,22)23)11-14(12-7-3-1-4-8-12)24-13-9-5-2-6-10-13;/h2*1,3-4,7-8,13H,2,5-6,9-11H2;/q2*-1;+2/b2*24-14-; |
| InChIKey | XMJULWFCOQCWQK-LGQFMZIISA-N |
| XLogP | 8.84 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.04 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|