C17H19F6NO — CID 101451069
4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-ol (PubChem CID 101451069) has the molecular formula C17H19F6NO and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-ol.
| Compound Name | 4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-ol |
|---|---|
| PubChem CID | 101451069 |
| Molecular Formula | C17H19F6NO |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-cyclohexylimino-1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-ol |
| SMILES | OC(C/C(=N\C1CCCCC1)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H19F6NO/c18-16(19,20)15(25,17(21,22)23)11-14(12-7-3-1-4-8-12)24-13-9-5-2-6-10-13/h1,3-4,7-8,13,25H,2,5-6,9-11H2/b24-14+ |
| InChIKey | JGMHAEYMRSVUAE-ZVHZXABRSA-N |
| XLogP | 5.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|