C17H15F10NO — CID 11396509
2,2,3,3,4,4,5-heptafluoro-1-(2-phenyl-2-propan-2-yliminoethyl)-5-(trifluoromethyl)cyclopentan-1-ol (PubChem CID 11396509) has the molecular formula C17H15F10NO and a molecular weight of 439.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluoro-1-(2-phenyl-2-propan-2-yliminoethyl)-5-(trifluoromethyl)cyclopentan-1-ol.
| Compound Name | 2,2,3,3,4,4,5-heptafluoro-1-(2-phenyl-2-propan-2-yliminoethyl)-5-(trifluoromethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 11396509 |
| Molecular Formula | C17H15F10NO |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluoro-1-(2-phenyl-2-propan-2-yliminoethyl)-5-(trifluoromethyl)cyclopentan-1-ol |
| SMILES | CC(C)/N=C(/CC1(O)C(F)(F)C(F)(F)C(F)(F)C1(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H15F10NO/c1-9(2)28-11(10-6-4-3-5-7-10)8-12(29)13(18,17(25,26)27)15(21,22)16(23,24)14(12,19)20/h3-7,9,29H,8H2,1-2H3/b28-11- |
| InChIKey | SWQGECVTXLUGIG-FXMZOFOKSA-N |
| XLogP | 5.20 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|