C14H18F3NO — CID 2759493
1,1,1-trifluoro-2-methyl-4-phenyl-4-propan-2-yliminobutan-2-ol (PubChem CID 2759493) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-methyl-4-phenyl-4-propan-2-yliminobutan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-methyl-4-phenyl-4-propan-2-yliminobutan-2-ol |
|---|---|
| PubChem CID | 2759493 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1,1,1-trifluoro-2-methyl-4-phenyl-4-propan-2-yliminobutan-2-ol |
| SMILES | CC(C)/N=C(/CC(C)(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H18F3NO/c1-10(2)18-12(11-7-5-4-6-8-11)9-13(3,19)14(15,16)17/h4-8,10,19H,9H2,1-3H3/b18-12- |
| InChIKey | KWVAYDZSGXTIKW-PDGQHHTCSA-N |
| XLogP | 3.59 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|