C17H22F3NO — CID 11012444
4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-phenylbutan-2-ol (PubChem CID 11012444) has the molecular formula C17H22F3NO and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-phenylbutan-2-ol.
| Compound Name | 4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 11012444 |
| Molecular Formula | C17H22F3NO |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-phenylbutan-2-ol |
| SMILES | CC(O)(C/C(=N\C1CCCCC1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO/c1-16(22,17(18,19)20)12-15(13-8-4-2-5-9-13)21-14-10-6-3-7-11-14/h2,4-5,8-9,14,22H,3,6-7,10-12H2,1H3/b21-15+ |
| InChIKey | QLGLFLLTMKWQGY-RCCKNPSSSA-N |
| XLogP | 4.51 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|