C14H15F6NO — CID 2759494
1,1,1-trifluoro-4-phenyl-4-propan-2-ylimino-2-(trifluoromethyl)butan-2-ol (PubChem CID 2759494) has the molecular formula C14H15F6NO and a molecular weight of 327.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-phenyl-4-propan-2-ylimino-2-(trifluoromethyl)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-phenyl-4-propan-2-ylimino-2-(trifluoromethyl)butan-2-ol |
|---|---|
| PubChem CID | 2759494 |
| Molecular Formula | C14H15F6NO |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1,1,1-trifluoro-4-phenyl-4-propan-2-ylimino-2-(trifluoromethyl)butan-2-ol |
| SMILES | CC(C)/N=C(/CC(O)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H15F6NO/c1-9(2)21-11(10-6-4-3-5-7-10)8-12(22,13(15,16)17)14(18,19)20/h3-7,9,22H,8H2,1-2H3/b21-11- |
| InChIKey | AENNWZZWTXDINQ-NHDPSOOVSA-N |
| XLogP | 4.13 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|