About (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol
(4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol (PubChem CID 5464796) has the molecular formula C12H11F6NO2
and a molecular weight of 315.21 g/mol. Its IUPAC name is (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol.
Molecular Properties
| Compound Name | (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol |
| PubChem CID | 5464796 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol |
| SMILES | O/N=C(/Cc1ccccc1)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F6NO2/c13-11(14,15)10(20,12(16,17)18)7-9(19-21)6-8-4-2-1-3-5-8/h1-5,20-21H,6-7H2/b19-9- |
| InChIKey | CSKPREQAWKWFCQ-OCKHKDLRSA-N |
| XLogP | 3.31 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol?
The IUPAC name of (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol (CID 5464796) is (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol.
What is the SMILES notation for (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol?
The canonical SMILES for (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol is O/N=C(/Cc1ccccc1)CC(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol?
The InChIKey is CSKPREQAWKWFCQ-OCKHKDLRSA-N. The full InChI is InChI=1S/C12H11F6NO2/c13-11(14,15)10(20,12(16,17)18)7-9(19-21)6-8-4-2-1-3-5-8/h1-5,20-21H,6-7H2/b19-9-.
What are the key properties of (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol?
(4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol has a molecular weight of 315.21 g/mol, XLogP of 3.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol is sourced from PubChem (CID 5464796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).