C11H8ClF6NO2 — CID 5351423
(4E)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-hydroxyimino-2-(trifluoromethyl)butan-2-ol (PubChem CID 5351423) has the molecular formula C11H8ClF6NO2 and a molecular weight of 335.63 g/mol. Its IUPAC name is (4E)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-hydroxyimino-2-(trifluoromethyl)butan-2-ol.
| Compound Name | (4E)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-hydroxyimino-2-(trifluoromethyl)butan-2-ol |
|---|---|
| PubChem CID | 5351423 |
| Molecular Formula | C11H8ClF6NO2 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (4E)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-hydroxyimino-2-(trifluoromethyl)butan-2-ol |
| SMILES | O/N=C(\CC(O)(C(F)(F)F)C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H8ClF6NO2/c12-7-3-1-2-6(4-7)8(19-21)5-9(20,10(13,14)15)11(16,17)18/h1-4,20-21H,5H2/b19-8+ |
| InChIKey | GVPYPKOPSXHWPD-UFWORHAWSA-N |
| XLogP | 3.76 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|