C10H7ClF3NO2 — CID 2881161
3-(4-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 2881161) has the molecular formula C10H7ClF3NO2 and a molecular weight of 265.62 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-(4-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 2881161 |
| Molecular Formula | C10H7ClF3NO2 |
| Molecular Weight | 265.62 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C10H7ClF3NO2/c11-7-3-1-6(2-4-7)8-5-9(16,17-15-8)10(12,13)14/h1-4,16H,5H2 |
| InChIKey | CJTYJGDSAQVEBI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |