C12H11F6NO2 — CID 5383436
(4E)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol (PubChem CID 5383436) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is (4E)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol.
| Compound Name | (4E)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 5383436 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (4E)-1,1,1-trifluoro-4-hydroxyimino-5-phenyl-2-(trifluoromethyl)pentan-2-ol |
| SMILES | O/N=C(\Cc1ccccc1)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F6NO2/c13-11(14,15)10(20,12(16,17)18)7-9(19-21)6-8-4-2-1-3-5-8/h1-5,20-21H,6-7H2/b19-9+ |
| InChIKey | CSKPREQAWKWFCQ-DJKKODMXSA-N |
| XLogP | 3.31 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|