C16H20Cl2N4O4 — CID 139151240
(6-carboxy-2-pyridinyl)methyl-[2-[(6-carboxy-2-pyridinyl)methylazaniumyl]ethyl]azanium dichloride (PubChem CID 139151240) has the molecular formula C16H20Cl2N4O4 and a molecular weight of 403.27 g/mol. Its IUPAC name is (6-carboxy-2-pyridinyl)methyl-[2-[(6-carboxy-2-pyridinyl)methylazaniumyl]ethyl]azanium dichloride.
| Compound Name | (6-carboxy-2-pyridinyl)methyl-[2-[(6-carboxy-2-pyridinyl)methylazaniumyl]ethyl]azanium dichloride |
|---|---|
| PubChem CID | 139151240 |
| Molecular Formula | C16H20Cl2N4O4 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (6-carboxy-2-pyridinyl)methyl-[2-[(6-carboxy-2-pyridinyl)methylazaniumyl]ethyl]azanium dichloride |
| SMILES | O=C(O)c1cccc(C[NH2+]CC[NH2+]Cc2cccc(C(=O)O)n2)n1.[Cl-].[Cl-] |
| InChI | InChI=1S/C16H18N4O4.2ClH/c21-15(22)13-5-1-3-11(19-13)9-17-7-8-18-10-12-4-2-6-14(20-12)16(23)24;;/h1-6,17-18H,7-10H2,(H,21,22)(H,23,24);2*1H |
| InChIKey | DWEXPOZBHBNAGZ-UHFFFAOYSA-N |
| XLogP | -7.29 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | -7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|