C19H16BrN5O2 — CID 139151467
2-(4-bromophenyl)-4,6-dipyridin-2-yl-1,3,5-triazine;dihydrate (PubChem CID 139151467) has the molecular formula C19H16BrN5O2 and a molecular weight of 426.27 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,6-dipyridin-2-yl-1,3,5-triazine;dihydrate.
| Compound Name | 2-(4-bromophenyl)-4,6-dipyridin-2-yl-1,3,5-triazine;dihydrate |
|---|---|
| PubChem CID | 139151467 |
| Molecular Formula | C19H16BrN5O2 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2-(4-bromophenyl)-4,6-dipyridin-2-yl-1,3,5-triazine;dihydrate |
| SMILES | Brc1ccc(-c2nc(-c3ccccn3)nc(-c3ccccn3)n2)cc1.O.O |
| InChI | InChI=1S/C19H12BrN5.2H2O/c20-14-9-7-13(8-10-14)17-23-18(15-5-1-3-11-21-15)25-19(24-17)16-6-2-4-12-22-16;;/h1-12H;2*1H2 |
| InChIKey | JBTURXAGHKXGBS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 127.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |