C17H17F3N4O4S — CID 139156242
N-pyridin-1-ium-2-yl-N-(pyridin-2-ylmethyl)pyridin-2-amine;trifluoromethanesulfonate;hydrate (PubChem CID 139156242) has the molecular formula C17H17F3N4O4S and a molecular weight of 430.41 g/mol. Its IUPAC name is N-pyridin-1-ium-2-yl-N-(pyridin-2-ylmethyl)pyridin-2-amine;trifluoromethanesulfonate;hydrate.
| Compound Name | N-pyridin-1-ium-2-yl-N-(pyridin-2-ylmethyl)pyridin-2-amine;trifluoromethanesulfonate;hydrate |
|---|---|
| PubChem CID | 139156242 |
| Molecular Formula | C17H17F3N4O4S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-pyridin-1-ium-2-yl-N-(pyridin-2-ylmethyl)pyridin-2-amine;trifluoromethanesulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])C(F)(F)F.c1ccc(CN(c2ccccn2)c2cccc[nH+]2)nc1 |
| InChI | InChI=1S/C16H14N4.CHF3O3S.H2O/c1-4-10-17-14(7-1)13-20(15-8-2-5-11-18-15)16-9-3-6-12-19-16;2-1(3,4)8(5,6)7;/h1-12H,13H2;(H,5,6,7);1H2 |
| InChIKey | YIOOJCOUAYCDEZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 131.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|