C38H32N4O4 — CID 139159867
3-[bis(1H-pyrrol-2-yl)methyl]-6-methylchromen-4-one (PubChem CID 139159867) has the molecular formula C38H32N4O4 and a molecular weight of 608.70 g/mol. Its IUPAC name is 3-[bis(1H-pyrrol-2-yl)methyl]-6-methylchromen-4-one.
| Compound Name | 3-[bis(1H-pyrrol-2-yl)methyl]-6-methylchromen-4-one |
|---|---|
| PubChem CID | 139159867 |
| Molecular Formula | C38H32N4O4 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 3-[bis(1H-pyrrol-2-yl)methyl]-6-methylchromen-4-one |
| SMILES | Cc1ccc2occ(C(c3ccc[nH]3)c3ccc[nH]3)c(=O)c2c1.Cc1ccc2occ(C(c3ccc[nH]3)c3ccc[nH]3)c(=O)c2c1 |
| InChI | InChI=1S/2C19H16N2O2/c2*1-12-6-7-17-13(10-12)19(22)14(11-23-17)18(15-4-2-8-20-15)16-5-3-9-21-16/h2*2-11,18,20-21H,1H3 |
| InChIKey | BNWGMEYSARRKIH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |