C22H30N2 — CID 139162238
(3S)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine;(3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine (PubChem CID 139162238) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is (3S)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine;(3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine.
| Compound Name | (3S)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine;(3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine |
|---|---|
| PubChem CID | 139162238 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | (3S)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine;(3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine |
| SMILES | C[C@@H]1CC(N(C)C)=C2C=CC=C21.C[C@H]1CC(N(C)C)=C2C=CC=C21 |
| InChI | InChI=1S/2C11H15N/c2*1-8-7-11(12(2)3)10-6-4-5-9(8)10/h2*4-6,8H,7H2,1-3H3/t2*8-/m10/s1 |
| InChIKey | KEPCSTRTNNDRHQ-RMTNWKGQSA-N |
| XLogP | 4.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |