C53H40BFeN6O2 — CID 139163985
CID 139163985 (PubChem CID 139163985) has the molecular formula C53H40BFeN6O2 and a molecular weight of 859.60 g/mol.
| Compound Name | CID 139163985 |
|---|---|
| PubChem CID | 139163985 |
| Molecular Formula | C53H40BFeN6O2 |
| Molecular Weight | 859.60 g/mol |
| Exact Mass | 859.27 |
| IUPAC Name | — |
| SMILES | CC(=O)c1ccccc1[O-].[Fe+2].c1ccc(-c2cc(-c3ccccc3)n([B-](n3nc(-c4ccccc4)cc3-c3ccccc3)n3nc(-c4ccccc4)cc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C45H33BN6.C8H8O2.Fe/c1-7-19-34(20-8-1)40-31-43(37-25-13-4-14-26-37)50(47-40)46(51-44(38-27-15-5-16-28-38)32-41(48-51)35-21-9-2-10-22-35)52-45(39-29-17-6-18-30-39)33-42(49-52)36-23-11-3-12-24-36;1-6(9)7-4-2-3-5-8(7)10;/h1-33H;2-5,10H,1H3;/q-1;;+2/p-1 |
| InChIKey | FDSVBCXAYXGOPC-UHFFFAOYSA-M |
| XLogP | 11.17 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.60 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|