C30H36N8O13 — CID 139164240
tris[2-[(5-methoxycarbonylpyridine-2-carbonyl)amino]ethyl]azanium;nitrate;hydrate (PubChem CID 139164240) has the molecular formula C30H36N8O13 and a molecular weight of 716.66 g/mol. Its IUPAC name is tris[2-[(5-methoxycarbonylpyridine-2-carbonyl)amino]ethyl]azanium;nitrate;hydrate.
| Compound Name | tris[2-[(5-methoxycarbonylpyridine-2-carbonyl)amino]ethyl]azanium;nitrate;hydrate |
|---|---|
| PubChem CID | 139164240 |
| Molecular Formula | C30H36N8O13 |
| Molecular Weight | 716.66 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | tris[2-[(5-methoxycarbonylpyridine-2-carbonyl)amino]ethyl]azanium;nitrate;hydrate |
| SMILES | COC(=O)c1ccc(C(=O)NCC[NH+](CCNC(=O)c2ccc(C(=O)OC)cn2)CCNC(=O)c2ccc(C(=O)OC)cn2)nc1.O.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C30H33N7O9.NO3.H2O/c1-44-28(41)19-4-7-22(34-16-19)25(38)31-10-13-37(14-11-32-26(39)23-8-5-20(17-35-23)29(42)45-2)15-12-33-27(40)24-9-6-21(18-36-24)30(43)46-3;2-1(3)4;/h4-9,16-18H,10-15H2,1-3H3,(H,31,38)(H,32,39)(H,33,40);;1H2/q;-1;/p+1 |
| InChIKey | RCWIYDPVNQISMX-UHFFFAOYSA-O |
| XLogP | -2.36 |
| TPSA | 307.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.66 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|