C31H45F3N2O3SSi — CID 139166262
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-trimethylsilane;trifluoromethanesulfonate (PubChem CID 139166262) has the molecular formula C31H45F3N2O3SSi and a molecular weight of 610.86 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-trimethylsilane;trifluoromethanesulfonate.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-trimethylsilane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139166262 |
| Molecular Formula | C31H45F3N2O3SSi |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-trimethylsilane;trifluoromethanesulfonate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[Si](C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C30H45N2Si.CHF3O3S/c1-20(2)24-14-12-15-25(21(3)4)28(24)31-18-19-32(30(31)33(9,10)11)29-26(22(5)6)16-13-17-27(29)23(7)8;2-1(3,4)8(5,6)7/h12-23H,1-11H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | RQSJTZRNLVMTSG-UHFFFAOYSA-M |
| XLogP | 7.84 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|