C13H24N2 — CID 139166270
1,3-ditert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-ide (PubChem CID 139166270) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1,3-ditert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-ide.
| Compound Name | 1,3-ditert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 139166270 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1,3-ditert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-ide |
| SMILES | Cc1c(C)[n+](C(C)(C)C)[c-]n1C(C)(C)C |
| InChI | InChI=1S/C13H24N2/c1-10-11(2)15(13(6,7)8)9-14(10)12(3,4)5/h1-8H3 |
| InChIKey | ZRDMSLSZJGZKHJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|