C19H32N4 — CID 139042431
1-tert-butyl-3-[(3-tert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-id-1-yl)methyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide (PubChem CID 139042431) has the molecular formula C19H32N4 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-tert-butyl-3-[(3-tert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-id-1-yl)methyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide.
| Compound Name | 1-tert-butyl-3-[(3-tert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-id-1-yl)methyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 139042431 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-tert-butyl-3-[(3-tert-butyl-4,5-dimethyl-2H-imidazol-1-ium-2-id-1-yl)methyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide |
| SMILES | Cc1c(C)[n+](C(C)(C)C)[c-]n1C[n+]1[c-]n(C(C)(C)C)c(C)c1C |
| InChI | InChI=1S/C19H32N4/c1-14-16(3)22(18(5,6)7)12-20(14)11-21-13-23(19(8,9)10)17(4)15(21)2/h11H2,1-10H3 |
| InChIKey | HEHMPHSJMBLRIN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|