C8H12N14O3 — CID 139170751
5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine;5-nitro-1H-1,2,4-triazol-3-olate (PubChem CID 139170751) has the molecular formula C8H12N14O3 and a molecular weight of 352.28 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine;5-nitro-1H-1,2,4-triazol-3-olate.
| Compound Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine;5-nitro-1H-1,2,4-triazol-3-olate |
|---|---|
| PubChem CID | 139170751 |
| Molecular Formula | C8H12N14O3 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine;5-nitro-1H-1,2,4-triazol-3-olate |
| SMILES | Nc1nnc(/C=C/c2[nH]nc(N)[n+]2N)n1N.O=[N+]([O-])c1nc([O-])n[nH]1 |
| InChI | InChI=1S/C6H10N10.C2H2N4O3/c7-5-13-11-3(15(5)9)1-2-4-12-14-6(8)16(4)10;7-2-3-1(4-5-2)6(8)9/h1-2H,9-10H2,(H4,7,8,11,12,13,14);(H2,3,4,5,7) |
| InChIKey | KNHROBVEOCVMML-UHFFFAOYSA-N |
| XLogP | -4.16 |
| TPSA | 275.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|