C8H16N20O2 — CID 139170756
(E)-bis(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)diazene;5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine;dihydrate (PubChem CID 139170756) has the molecular formula C8H16N20O2 and a molecular weight of 424.35 g/mol. Its IUPAC name is (E)-bis(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)diazene;5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine;dihydrate.
| Compound Name | (E)-bis(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)diazene;5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine;dihydrate |
|---|---|
| PubChem CID | 139170756 |
| Molecular Formula | C8H16N20O2 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (E)-bis(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)diazene;5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine;dihydrate |
| SMILES | N(=N/c1nnn[n-]1)\c1nnn[n-]1.Nc1n[nH]c(/C=C/c2[nH]nc(N)[n+]2N)[n+]1N.O.O |
| InChI | InChI=1S/C6H10N10.C2N10.2H2O/c7-5-13-11-3(15(5)9)1-2-4-12-14-6(8)16(4)10;3(1-5-9-10-6-1)4-2-7-11-12-8-2;;/h1-2H,9-10H2,(H4,7,8,11,12,13,14);;2*1H2/q;-2;;/p+2/b;4-3+;; |
| InChIKey | DEQAESCRVYAUNK-NXZCPFRHSA-P |
| XLogP | -6.79 |
| TPSA | 362.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | -6.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|