C22H44B4O8 — CID 139172509
5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborinane (PubChem CID 139172509) has the molecular formula C22H44B4O8 and a molecular weight of 479.83 g/mol. Its IUPAC name is 5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborinane.
| Compound Name | 5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 139172509 |
| Molecular Formula | C22H44B4O8 |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 480.34 |
| IUPAC Name | 5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(B2OC(C)(C)C(C)(C)O2)OC1.CC1(C)COB(B2OC(C)(C)C(C)(C)O2)OC1 |
| InChI | InChI=1S/2C11H22B2O4/c2*1-9(2)7-14-12(15-8-9)13-16-10(3,4)11(5,6)17-13/h2*7-8H2,1-6H3 |
| InChIKey | BGJISWANHSVHQP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|