C20H40B4O8 — CID 160557818
2-(1,3,2-dioxaborinan-2-ylmethyl)-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane (PubChem CID 160557818) has the molecular formula C20H40B4O8 and a molecular weight of 451.78 g/mol. Its IUPAC name is 2-(1,3,2-dioxaborinan-2-ylmethyl)-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane.
| Compound Name | 2-(1,3,2-dioxaborinan-2-ylmethyl)-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 160557818 |
| Molecular Formula | C20H40B4O8 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 2-(1,3,2-dioxaborinan-2-ylmethyl)-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane |
| SMILES | C1COB(CB2OCCCO2)OC1.CC1(C)OB(CB2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C13H26B2O4.C7H14B2O4/c1-10(2)11(3,4)17-14(16-10)9-15-18-12(5,6)13(7,8)19-15;1-3-10-8(11-4-1)7-9-12-5-2-6-13-9/h9H2,1-8H3;1-7H2 |
| InChIKey | QYXNCGSNVSDVCG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|