C28H33CuN3O2 — CID 139173504
copper 2,4-ditert-butyl-6-[[2-[(S)-methoxy(pyridin-2-yl)methyl]azanidylphenyl]methylideneamino]phenolate (PubChem CID 139173504) has the molecular formula C28H33CuN3O2 and a molecular weight of 507.14 g/mol. Its IUPAC name is copper 2,4-ditert-butyl-6-[[2-[(S)-methoxy(pyridin-2-yl)methyl]azanidylphenyl]methylideneamino]phenolate.
| Compound Name | copper 2,4-ditert-butyl-6-[[2-[(S)-methoxy(pyridin-2-yl)methyl]azanidylphenyl]methylideneamino]phenolate |
|---|---|
| PubChem CID | 139173504 |
| Molecular Formula | C28H33CuN3O2 |
| Molecular Weight | 507.14 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | copper 2,4-ditert-butyl-6-[[2-[(S)-methoxy(pyridin-2-yl)methyl]azanidylphenyl]methylideneamino]phenolate |
| SMILES | CO[C@H]([N-]c1ccccc1/C=N/c1cc(C(C)(C)C)cc(C(C)(C)C)c1[O-])c1ccccn1.[Cu+2] |
| InChI | InChI=1S/C28H34N3O2.Cu/c1-27(2,3)20-16-21(28(4,5)6)25(32)24(17-20)30-18-19-12-8-9-13-22(19)31-26(33-7)23-14-10-11-15-29-23;/h8-18,26H,1-7H3,(H-,30,31,32);/q-1;+2/p-1/t26-;/m0./s1 |
| InChIKey | CEHSUHQDNIYGGR-SNYZSRNZSA-M |
| XLogP | 6.85 |
| TPSA | 71.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.14 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|