C28H24FNO2 — CID 139174296
4-fluoro-2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol (PubChem CID 139174296) has the molecular formula C28H24FNO2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 4-fluoro-2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol.
| Compound Name | 4-fluoro-2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139174296 |
| Molecular Formula | C28H24FNO2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-fluoro-2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol |
| SMILES | Oc1ccc(F)cc1/C=N/[C@@H](Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24FNO2/c29-25-16-17-26(31)22(19-25)20-30-27(18-21-10-4-1-5-11-21)28(32,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-17,19-20,27,31-32H,18H2/b30-20+/t27-/m0/s1 |
| InChIKey | RZECIOAYDBGYRS-QNBFMKIVSA-N |
| XLogP | 5.50 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|