C28H30N6O12S2 — CID 139176251
6,13-bis[3-(1H-imidazol-3-ium-3-yl)propyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;methyl sulfate (PubChem CID 139176251) has the molecular formula C28H30N6O12S2 and a molecular weight of 706.71 g/mol. Its IUPAC name is 6,13-bis[3-(1H-imidazol-3-ium-3-yl)propyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;methyl sulfate.
| Compound Name | 6,13-bis[3-(1H-imidazol-3-ium-3-yl)propyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;methyl sulfate |
|---|---|
| PubChem CID | 139176251 |
| Molecular Formula | C28H30N6O12S2 |
| Molecular Weight | 706.71 g/mol |
| Exact Mass | 706.14 |
| IUPAC Name | 6,13-bis[3-(1H-imidazol-3-ium-3-yl)propyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].COS(=O)(=O)[O-].O=C1c2ccc3c4c(ccc(c24)C(=O)N1CCC[n+]1cc[nH]c1)C(=O)N(CCC[n+]1cc[nH]c1)C3=O |
| InChI | InChI=1S/C26H22N6O4.2CH4O4S/c33-23-17-3-5-19-22-20(26(36)32(25(19)35)12-2-10-30-14-8-28-16-30)6-4-18(21(17)22)24(34)31(23)11-1-9-29-13-7-27-15-29;2*1-5-6(2,3)4/h3-8,13-16H,1-2,9-12H2;2*1H3,(H,2,3,4) |
| InChIKey | ITMHPVNOTJYUSV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 246.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.71 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|